C17H20NO11P — CID 66847755
2-[(2R,3S,4S,5S,6S)-6-[2-(1,3-dioxoisoindol-4-yl)oxyethoxy]-3,4,5-trihydroxyoxan-2-yl]ethenylphosphonic acid (PubChem CID 66847755) has the molecular formula C17H20NO11P and a molecular weight of 445.32 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5S,6S)-6-[2-(1,3-dioxoisoindol-4-yl)oxyethoxy]-3,4,5-trihydroxyoxan-2-yl]ethenylphosphonic acid.
| Compound Name | 2-[(2R,3S,4S,5S,6S)-6-[2-(1,3-dioxoisoindol-4-yl)oxyethoxy]-3,4,5-trihydroxyoxan-2-yl]ethenylphosphonic acid |
|---|---|
| PubChem CID | 66847755 |
| Molecular Formula | C17H20NO11P |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-[(2R,3S,4S,5S,6S)-6-[2-(1,3-dioxoisoindol-4-yl)oxyethoxy]-3,4,5-trihydroxyoxan-2-yl]ethenylphosphonic acid |
| SMILES | O=C1NC(=O)c2c(OCCO[C@H]3O[C@H](C=CP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H]3O)cccc21 |
| InChI | InChI=1S/C17H20NO11P/c19-12-10(4-7-30(24,25)26)29-17(14(21)13(12)20)28-6-5-27-9-3-1-2-8-11(9)16(23)18-15(8)22/h1-4,7,10,12-14,17,19-21H,5-6H2,(H,18,22,23)(H2,24,25,26)/t10-,12-,13+,14+,17+/m1/s1 |
| InChIKey | MZYYMAMQZCCERW-ZLQDYUCGSA-N |
| XLogP | -1.54 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|