C18H25N3O3S — CID 66848019
tert-butyl N-[(8aS)-8a-(3-aminophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamate (PubChem CID 66848019) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is tert-butyl N-[(8aS)-8a-(3-aminophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(8aS)-8a-(3-aminophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 66848019 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | tert-butyl N-[(8aS)-8a-(3-aminophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[3,4-e][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=NCC2COCC[C@]2(c2cccc(N)c2)S1 |
| InChI | InChI=1S/C18H25N3O3S/c1-17(2,3)24-16(22)21-15-20-10-13-11-23-8-7-18(13,25-15)12-5-4-6-14(19)9-12/h4-6,9,13H,7-8,10-11,19H2,1-3H3,(H,20,21,22)/t13?,18-/m1/s1 |
| InChIKey | FFTPWOVITROFOR-PQJIZZRHSA-N |
| XLogP | 3.13 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|