C19H18FN3O2S — CID 66848033
N-[(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]benzamide (PubChem CID 66848033) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 66848033 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-[(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-e][1,3]thiazin-2-yl]benzamide |
| SMILES | Nc1ccc(F)c([C@]23COC[C@@H]2CN=C(NC(=O)c2ccccc2)S3)c1 |
| InChI | InChI=1S/C19H18FN3O2S/c20-16-7-6-14(21)8-15(16)19-11-25-10-13(19)9-22-18(26-19)23-17(24)12-4-2-1-3-5-12/h1-8,13H,9-11,21H2,(H,22,23,24)/t13-,19-/m0/s1 |
| InChIKey | ZLNWDOAIHDKSRW-DJJJIMSYSA-N |
| XLogP | 2.78 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|