About (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate
(2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate (PubChem CID 66848289) has the molecular formula C8H8O6
and a molecular weight of 200.15 g/mol. Its IUPAC name is (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate |
| PubChem CID | 66848289 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate |
| SMILES | O=C(O)OC1=C(OC(=O)O)CCC=C1 |
| InChI | InChI=1S/C8H8O6/c9-7(10)13-5-3-1-2-4-6(5)14-8(11)12/h1,3H,2,4H2,(H,9,10)(H,11,12) |
| InChIKey | WXYWNDZYQLPAFF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate?
The IUPAC name of (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate (CID 66848289) is (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate.
What is the SMILES notation for (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate?
The canonical SMILES for (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate is O=C(O)OC1=C(OC(=O)O)CCC=C1.
What is the InChIKey of (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate?
The InChIKey is WXYWNDZYQLPAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O6/c9-7(10)13-5-3-1-2-4-6(5)14-8(11)12/h1,3H,2,4H2,(H,9,10)(H,11,12).
What are the key properties of (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate?
(2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate has a molecular weight of 200.15 g/mol, XLogP of 1.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carboxyoxycyclohexa-1,3-dien-1-yl) hydrogen carbonate is sourced from PubChem (CID 66848289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).