C15H18N2 — CID 66848577
4,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene (PubChem CID 66848577) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | 4,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 66848577 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4,9-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3,5,7-tetraene |
| SMILES | Cc1cccc2c1c1c(n2C)CC2CCC1N2 |
| InChI | InChI=1S/C15H18N2/c1-9-4-3-5-12-14(9)15-11-7-6-10(16-11)8-13(15)17(12)2/h3-5,10-11,16H,6-8H2,1-2H3 |
| InChIKey | RNTIVZJFKZAYDQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |