About N-(2,2-dimethoxyethyl)piperazin-1-amine
N-(2,2-dimethoxyethyl)piperazin-1-amine (PubChem CID 66848844) has the molecular formula C8H19N3O2
and a molecular weight of 189.26 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)piperazin-1-amine.
Molecular Properties
| Compound Name | N-(2,2-dimethoxyethyl)piperazin-1-amine |
| PubChem CID | 66848844 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)piperazin-1-amine |
| SMILES | COC(CNN1CCNCC1)OC |
| InChI | InChI=1S/C8H19N3O2/c1-12-8(13-2)7-10-11-5-3-9-4-6-11/h8-10H,3-7H2,1-2H3 |
| InChIKey | FXNTVUZJCDZGTF-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-dimethoxyethyl)piperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethoxyethyl)piperazin-1-amine?
The IUPAC name of N-(2,2-dimethoxyethyl)piperazin-1-amine (CID 66848844) is N-(2,2-dimethoxyethyl)piperazin-1-amine.
What is the SMILES notation for N-(2,2-dimethoxyethyl)piperazin-1-amine?
The canonical SMILES for N-(2,2-dimethoxyethyl)piperazin-1-amine is COC(CNN1CCNCC1)OC.
What is the InChIKey of N-(2,2-dimethoxyethyl)piperazin-1-amine?
The InChIKey is FXNTVUZJCDZGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3O2/c1-12-8(13-2)7-10-11-5-3-9-4-6-11/h8-10H,3-7H2,1-2H3.
What are the key properties of N-(2,2-dimethoxyethyl)piperazin-1-amine?
N-(2,2-dimethoxyethyl)piperazin-1-amine has a molecular weight of 189.26 g/mol, XLogP of -0.98, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethoxyethyl)piperazin-1-amine is sourced from PubChem (CID 66848844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).