C10H13N3 — CID 66849171
3,5-diethyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 66849171) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 3,5-diethyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3,5-diethyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 66849171 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3,5-diethyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CCc1cccc2nnc(CC)n12 |
| InChI | InChI=1S/C10H13N3/c1-3-8-6-5-7-10-12-11-9(4-2)13(8)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | QWSIVYLGRQRYLC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |