About CID 66849194
CID 66849194 (PubChem CID 66849194) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol.
Molecular Properties
| Compound Name | CID 66849194 |
| PubChem CID | 66849194 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | — |
| SMILES | [N-]=[N+]=N.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.HN3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1-10H;1H |
| InChIKey | BDMMPCHHMPDSDH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 66849194 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66849194?
The IUPAC name of CID 66849194 (CID 66849194) is not available.
What is the SMILES notation for CID 66849194?
The canonical SMILES for CID 66849194 is [N-]=[N+]=N.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of CID 66849194?
The InChIKey is BDMMPCHHMPDSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.HN3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h1-10H;1H.
What are the key properties of CID 66849194?
CID 66849194 has a molecular weight of 197.24 g/mol, XLogP of 4.23, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66849194 is sourced from PubChem (CID 66849194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).