C12H15NO — CID 66849423
3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 66849423) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 66849423 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3,4,4a,5,6,6a-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | C1=CC2=C3OCCCC3CNC2C=C1 |
| InChI | InChI=1S/C12H15NO/c1-2-6-11-10(5-1)12-9(8-13-11)4-3-7-14-12/h1-2,5-6,9,11,13H,3-4,7-8H2 |
| InChIKey | UQQTXEWMLMKXEH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |