C18H22O3 — CID 66849488
4-[(2,5-dimethylphenyl)methyl]-4-hydroxy-2,6-dimethylhepta-1,6-diene-3,5-dione (PubChem CID 66849488) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)methyl]-4-hydroxy-2,6-dimethylhepta-1,6-diene-3,5-dione.
| Compound Name | 4-[(2,5-dimethylphenyl)methyl]-4-hydroxy-2,6-dimethylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 66849488 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)methyl]-4-hydroxy-2,6-dimethylhepta-1,6-diene-3,5-dione |
| SMILES | C=C(C)C(=O)C(O)(Cc1cc(C)ccc1C)C(=O)C(=C)C |
| InChI | InChI=1S/C18H22O3/c1-11(2)16(19)18(21,17(20)12(3)4)10-15-9-13(5)7-8-14(15)6/h7-9,21H,1,3,10H2,2,4-6H3 |
| InChIKey | FOZKEPGYQOIIRV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|