About 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole
2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole (PubChem CID 66850021) has the molecular formula C15H8F3N3O
and a molecular weight of 303.24 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole |
| PubChem CID | 66850021 |
| Molecular Formula | C15H8F3N3O |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole |
| SMILES | FC(F)(F)c1ncc2ccc(-c3nc4ccccc4o3)cn12 |
| InChI | InChI=1S/C15H8F3N3O/c16-15(17,18)14-19-7-10-6-5-9(8-21(10)14)13-20-11-3-1-2-4-12(11)22-13/h1-8H |
| InChIKey | MDRGNEYIEZTERO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole?
The IUPAC name of 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole (CID 66850021) is 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole.
What is the SMILES notation for 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole?
The canonical SMILES for 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole is FC(F)(F)c1ncc2ccc(-c3nc4ccccc4o3)cn12.
What is the InChIKey of 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole?
The InChIKey is MDRGNEYIEZTERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F3N3O/c16-15(17,18)14-19-7-10-6-5-9(8-21(10)14)13-20-11-3-1-2-4-12(11)22-13/h1-8H.
What are the key properties of 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole?
2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole has a molecular weight of 303.24 g/mol, XLogP of 4.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(trifluoromethyl)imidazo[1,5-a]pyridin-6-yl]-1,3-benzoxazole is sourced from PubChem (CID 66850021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).