C26H30N2 — CID 66850189
1-[(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole (PubChem CID 66850189) has the molecular formula C26H30N2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-[(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole.
| Compound Name | 1-[(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
|---|---|
| PubChem CID | 66850189 |
| Molecular Formula | C26H30N2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-[(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
| SMILES | C[C@]12CCC=CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C26H30N2/c1-25-15-6-5-7-18(25)10-11-19-20-12-13-24(26(20,2)16-14-21(19)25)28-17-27-22-8-3-4-9-23(22)28/h3-5,7-10,13,17,19-21H,6,11-12,14-16H2,1-2H3/t19-,20-,21-,25-,26-/m0/s1 |
| InChIKey | SPEDTVSELPTCNP-HKGZJRCASA-N |
| XLogP | 6.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |