C28H31FN4OSi — CID 66850271
N-[6-(azetidin-1-yl)-3-pyridinyl]-5-[ethyl(dimethyl)silyl]-1-[(3-fluorophenyl)methyl]indole-2-carboxamide (PubChem CID 66850271) has the molecular formula C28H31FN4OSi and a molecular weight of 486.67 g/mol. Its IUPAC name is N-[6-(azetidin-1-yl)-3-pyridinyl]-5-[ethyl(dimethyl)silyl]-1-[(3-fluorophenyl)methyl]indole-2-carboxamide.
| Compound Name | N-[6-(azetidin-1-yl)-3-pyridinyl]-5-[ethyl(dimethyl)silyl]-1-[(3-fluorophenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 66850271 |
| Molecular Formula | C28H31FN4OSi |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[6-(azetidin-1-yl)-3-pyridinyl]-5-[ethyl(dimethyl)silyl]-1-[(3-fluorophenyl)methyl]indole-2-carboxamide |
| SMILES | CC[Si](C)(C)c1ccc2c(c1)cc(C(=O)Nc1ccc(N3CCC3)nc1)n2Cc1cccc(F)c1 |
| InChI | InChI=1S/C28H31FN4OSi/c1-4-35(2,3)24-10-11-25-21(16-24)17-26(33(25)19-20-7-5-8-22(29)15-20)28(34)31-23-9-12-27(30-18-23)32-13-6-14-32/h5,7-12,15-18H,4,6,13-14,19H2,1-3H3,(H,31,34) |
| InChIKey | NTERDZQESYPOJZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|