C26H34N2O — CID 66850277
(8R,9S,10S,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 66850277) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10S,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 66850277 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | (8R,9S,10S,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)CC[C@@H]12 |
| InChI | InChI=1S/C26H34N2O/c1-25-13-11-18(29)15-17(25)7-8-19-20-9-10-24(26(20,2)14-12-21(19)25)28-16-27-22-5-3-4-6-23(22)28/h3-6,16-17,19-21,24H,7-15H2,1-2H3/t17?,19-,20-,21-,24?,25-,26-/m0/s1 |
| InChIKey | XNHVMGGXTZYNFS-YONTVKDDSA-N |
| XLogP | 6.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |