About 3-propan-2-ylbenzene-1,2,4-triamine
3-propan-2-ylbenzene-1,2,4-triamine (PubChem CID 66850331) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-propan-2-ylbenzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 3-propan-2-ylbenzene-1,2,4-triamine |
| PubChem CID | 66850331 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3-propan-2-ylbenzene-1,2,4-triamine |
| SMILES | CC(C)c1c(N)ccc(N)c1N |
| InChI | InChI=1S/C9H15N3/c1-5(2)8-6(10)3-4-7(11)9(8)12/h3-5H,10-12H2,1-2H3 |
| InChIKey | YPNRIXBTTTYABI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-ylbenzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylbenzene-1,2,4-triamine?
The IUPAC name of 3-propan-2-ylbenzene-1,2,4-triamine (CID 66850331) is 3-propan-2-ylbenzene-1,2,4-triamine.
What is the SMILES notation for 3-propan-2-ylbenzene-1,2,4-triamine?
The canonical SMILES for 3-propan-2-ylbenzene-1,2,4-triamine is CC(C)c1c(N)ccc(N)c1N.
What is the InChIKey of 3-propan-2-ylbenzene-1,2,4-triamine?
The InChIKey is YPNRIXBTTTYABI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-5(2)8-6(10)3-4-7(11)9(8)12/h3-5H,10-12H2,1-2H3.
What are the key properties of 3-propan-2-ylbenzene-1,2,4-triamine?
3-propan-2-ylbenzene-1,2,4-triamine has a molecular weight of 165.24 g/mol, XLogP of 1.56, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylbenzene-1,2,4-triamine is sourced from PubChem (CID 66850331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).