About 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine
3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine (PubChem CID 66850558) has the molecular formula C6H5Br2Cl2N
and a molecular weight of 321.83 g/mol. Its IUPAC name is 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine.
Molecular Properties
| Compound Name | 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine |
| PubChem CID | 66850558 |
| Molecular Formula | C6H5Br2Cl2N |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 318.82 |
| IUPAC Name | 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine |
| SMILES | CC1=CC(Cl)=NC(Cl)C1(Br)Br |
| InChI | InChI=1S/C6H5Br2Cl2N/c1-3-2-4(9)11-5(10)6(3,7)8/h2,5H,1H3 |
| InChIKey | CVRAXBCXVLJSCN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine?
The IUPAC name of 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine (CID 66850558) is 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine.
What is the SMILES notation for 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine?
The canonical SMILES for 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine is CC1=CC(Cl)=NC(Cl)C1(Br)Br.
What is the InChIKey of 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine?
The InChIKey is CVRAXBCXVLJSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br2Cl2N/c1-3-2-4(9)11-5(10)6(3,7)8/h2,5H,1H3.
What are the key properties of 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine?
3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine has a molecular weight of 321.83 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibromo-2,6-dichloro-4-methyl-2H-pyridine is sourced from PubChem (CID 66850558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).