C20H23ClN6O5S — CID 66850582
5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-(2-pyrimidin-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 66850582) has the molecular formula C20H23ClN6O5S and a molecular weight of 494.96 g/mol. Its IUPAC name is 5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-(2-pyrimidin-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-(2-pyrimidin-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66850582 |
| Molecular Formula | C20H23ClN6O5S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-(2-pyrimidin-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCc2ncccn2)(CS(=O)(=O)N2CCC(Oc3ccc(Cl)cn3)CC2)N1 |
| InChI | InChI=1S/C20H23ClN6O5S/c21-14-2-3-17(24-12-14)32-15-5-10-27(11-6-15)33(30,31)13-20(18(28)25-19(29)26-20)7-4-16-22-8-1-9-23-16/h1-3,8-9,12,15H,4-7,10-11,13H2,(H2,25,26,28,29) |
| InChIKey | CMKYNWWFTQYSKI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|