About 9-hexyl-9H-fluorene-2,7-diamine
9-hexyl-9H-fluorene-2,7-diamine (PubChem CID 66850655) has the molecular formula C19H24N2
and a molecular weight of 280.42 g/mol. Its IUPAC name is 9-hexyl-9H-fluorene-2,7-diamine.
Molecular Properties
| Compound Name | 9-hexyl-9H-fluorene-2,7-diamine |
| PubChem CID | 66850655 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 9-hexyl-9H-fluorene-2,7-diamine |
| SMILES | CCCCCCC1c2cc(N)ccc2-c2ccc(N)cc21 |
| InChI | InChI=1S/C19H24N2/c1-2-3-4-5-6-15-18-11-13(20)7-9-16(18)17-10-8-14(21)12-19(15)17/h7-12,15H,2-6,20-21H2,1H3 |
| InChIKey | FHJRYFHTTJVYDJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-hexyl-9H-fluorene-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hexyl-9H-fluorene-2,7-diamine?
The IUPAC name of 9-hexyl-9H-fluorene-2,7-diamine (CID 66850655) is 9-hexyl-9H-fluorene-2,7-diamine.
What is the SMILES notation for 9-hexyl-9H-fluorene-2,7-diamine?
The canonical SMILES for 9-hexyl-9H-fluorene-2,7-diamine is CCCCCCC1c2cc(N)ccc2-c2ccc(N)cc21.
What is the InChIKey of 9-hexyl-9H-fluorene-2,7-diamine?
The InChIKey is FHJRYFHTTJVYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2/c1-2-3-4-5-6-15-18-11-13(20)7-9-16(18)17-10-8-14(21)12-19(15)17/h7-12,15H,2-6,20-21H2,1H3.
What are the key properties of 9-hexyl-9H-fluorene-2,7-diamine?
9-hexyl-9H-fluorene-2,7-diamine has a molecular weight of 280.42 g/mol, XLogP of 4.93, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hexyl-9H-fluorene-2,7-diamine is sourced from PubChem (CID 66850655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).