About 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane)
1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) (PubChem CID 66850804) has the molecular formula C36H68O2
and a molecular weight of 532.94 g/mol. Its IUPAC name is 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane).
Molecular Properties
| Compound Name | 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) |
| PubChem CID | 66850804 |
| Molecular Formula | C36H68O2 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.52 |
| IUPAC Name | 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) |
| SMILES | C1CCCCCCCCC1.C1CCCCCCCCC1.C=COCC1(COC=C)CCCCCCCCC1 |
| InChI | InChI=1S/C16H28O2.2C10H20/c1-3-17-14-16(15-18-4-2)12-10-8-6-5-7-9-11-13-16;2*1-2-4-6-8-10-9-7-5-3-1/h3-4H,1-2,5-15H2;2*1-10H2 |
| InChIKey | UTGOKYPPOVCYFW-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane)?
The IUPAC name of 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) (CID 66850804) is 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane).
What is the SMILES notation for 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane)?
The canonical SMILES for 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) is C1CCCCCCCCC1.C1CCCCCCCCC1.C=COCC1(COC=C)CCCCCCCCC1.
What is the InChIKey of 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane)?
The InChIKey is UTGOKYPPOVCYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2.2C10H20/c1-3-17-14-16(15-18-4-2)12-10-8-6-5-7-9-11-13-16;2*1-2-4-6-8-10-9-7-5-3-1/h3-4H,1-2,5-15H2;2*1-10H2.
What are the key properties of 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane)?
1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) has a molecular weight of 532.94 g/mol, XLogP of 12.62, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(ethenoxymethyl)cyclodecane;bis(cyclodecane) is sourced from PubChem (CID 66850804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).