C18H27N3O2SSi — CID 66851774
6,6-dimethyl-2-[(3S)-3-(3-trimethylsilylprop-2-ynyl)morpholin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 66851774) has the molecular formula C18H27N3O2SSi and a molecular weight of 377.59 g/mol. Its IUPAC name is 6,6-dimethyl-2-[(3S)-3-(3-trimethylsilylprop-2-ynyl)morpholin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 6,6-dimethyl-2-[(3S)-3-(3-trimethylsilylprop-2-ynyl)morpholin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 66851774 |
| Molecular Formula | C18H27N3O2SSi |
| Molecular Weight | 377.59 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 6,6-dimethyl-2-[(3S)-3-(3-trimethylsilylprop-2-ynyl)morpholin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | CC1(C)Cc2nc(N3CCOC[C@@H]3CC#C[Si](C)(C)C)sc2C(=O)N1 |
| InChI | InChI=1S/C18H27N3O2SSi/c1-18(2)11-14-15(16(22)20-18)24-17(19-14)21-8-9-23-12-13(21)7-6-10-25(3,4)5/h13H,7-9,11-12H2,1-5H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | OLSTUYCUJWPLNT-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|