C15H18F3NO3S — CID 66851938
2-[4-[4-(trifluoromethylsulfanyl)anilino]cyclohexyl]oxyacetic acid (PubChem CID 66851938) has the molecular formula C15H18F3NO3S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethylsulfanyl)anilino]cyclohexyl]oxyacetic acid.
| Compound Name | 2-[4-[4-(trifluoromethylsulfanyl)anilino]cyclohexyl]oxyacetic acid |
|---|---|
| PubChem CID | 66851938 |
| Molecular Formula | C15H18F3NO3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[4-[4-(trifluoromethylsulfanyl)anilino]cyclohexyl]oxyacetic acid |
| SMILES | O=C(O)COC1CCC(Nc2ccc(SC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H18F3NO3S/c16-15(17,18)23-13-7-3-11(4-8-13)19-10-1-5-12(6-2-10)22-9-14(20)21/h3-4,7-8,10,12,19H,1-2,5-6,9H2,(H,20,21) |
| InChIKey | DNZMZPUWUAEVDX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |