C20H34O2 — CID 66852026
(1S,3R,4E,8E,12S,13E)-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-4,8,13-triene-1,3-diol (PubChem CID 66852026) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,3R,4E,8E,12S,13E)-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-4,8,13-triene-1,3-diol.
| Compound Name | (1S,3R,4E,8E,12S,13E)-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-4,8,13-triene-1,3-diol |
|---|---|
| PubChem CID | 66852026 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1S,3R,4E,8E,12S,13E)-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-4,8,13-triene-1,3-diol |
| SMILES | C/C1=C/CC/C(C)=C/CC[C@H](C)/C=C/[C@@](O)(C(C)C)C[C@H]1O |
| InChI | InChI=1S/C20H34O2/c1-15(2)20(22)13-12-17(4)9-6-8-16(3)10-7-11-18(5)19(21)14-20/h8,11-13,15,17,19,21-22H,6-7,9-10,14H2,1-5H3/b13-12+,16-8+,18-11-/t17-,19+,20-/m0/s1 |
| InChIKey | ZXLGWTDXLNZEIO-OGUCEFPMSA-N |
| XLogP | 4.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|