About 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride
2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride (PubChem CID 66852833) has the molecular formula C11H20Cl2N4O
and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride.
Molecular Properties
| Compound Name | 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride |
| PubChem CID | 66852833 |
| Molecular Formula | C11H20Cl2N4O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride |
| SMILES | CN1C=C2C(=O)N(C3CCNCC3)CN2C1.Cl.Cl |
| InChI | InChI=1S/C11H18N4O.2ClH/c1-13-6-10-11(16)15(8-14(10)7-13)9-2-4-12-5-3-9;;/h6,9,12H,2-5,7-8H2,1H3;2*1H |
| InChIKey | WANVJFBCXYMWLP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride?
The IUPAC name of 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride (CID 66852833) is 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride.
What is the SMILES notation for 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride?
The canonical SMILES for 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride is CN1C=C2C(=O)N(C3CCNCC3)CN2C1.Cl.Cl.
What is the InChIKey of 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride?
The InChIKey is WANVJFBCXYMWLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O.2ClH/c1-13-6-10-11(16)15(8-14(10)7-13)9-2-4-12-5-3-9;;/h6,9,12H,2-5,7-8H2,1H3;2*1H.
What are the key properties of 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride?
2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride has a molecular weight of 295.21 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one;dihydrochloride is sourced from PubChem (CID 66852833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).