About 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one
2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one (PubChem CID 66854224) has the molecular formula C13H23N5O
and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one |
| PubChem CID | 66854224 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one |
| SMILES | CN(C)CN1C=C2C(=O)N(C3CCNCC3)CN2C1 |
| InChI | InChI=1S/C13H23N5O/c1-15(2)8-16-7-12-13(19)18(10-17(12)9-16)11-3-5-14-6-4-11/h7,11,14H,3-6,8-10H2,1-2H3 |
| InChIKey | CNQRHJGPZYNLRX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one?
The IUPAC name of 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one (CID 66854224) is 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one.
What is the SMILES notation for 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one?
The canonical SMILES for 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one is CN(C)CN1C=C2C(=O)N(C3CCNCC3)CN2C1.
What is the InChIKey of 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one?
The InChIKey is CNQRHJGPZYNLRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5O/c1-15(2)8-16-7-12-13(19)18(10-17(12)9-16)11-3-5-14-6-4-11/h7,11,14H,3-6,8-10H2,1-2H3.
What are the key properties of 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one?
2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one has a molecular weight of 265.36 g/mol, XLogP of -0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methyl]-6-piperidin-4-yl-3,5-dihydroimidazo[1,5-c]imidazol-7-one is sourced from PubChem (CID 66854224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).