About CID 66854265
CID 66854265 (PubChem CID 66854265) has the molecular formula C43H58N5O6Si2
and a molecular weight of 797.14 g/mol.
Molecular Properties
| Compound Name | CID 66854265 |
| PubChem CID | 66854265 |
| Molecular Formula | C43H58N5O6Si2 |
| Molecular Weight | 797.14 g/mol |
| Exact Mass | 796.39 |
| IUPAC Name | — |
| SMILES | Cc1ccc(Cn2cc(C(=O)Nc3cc(-c4cc5cc(C(O[Si](C)C)C(C)(C)C)ccc5n4C(=O)OC(C)(C)C)c(=O)n(COCC[Si](C)(C)C)c3)cn2)cc1 |
| InChI | InChI=1S/C43H58N5O6Si2/c1-29-13-15-30(16-14-29)25-47-26-33(24-44-47)39(49)45-34-23-35(40(50)46(27-34)28-52-19-20-56(10,11)12)37-22-32-21-31(38(42(2,3)4)54-55(8)9)17-18-36(32)48(37)41(51)53-43(5,6)7/h13-18,21-24,26-27,38H,19-20,25,28H2,1-12H3,(H,45,49) |
| InChIKey | WPXCLYJREBRFGU-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 797.14 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66854265 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66854265?
The IUPAC name of CID 66854265 (CID 66854265) is not available.
What is the SMILES notation for CID 66854265?
The canonical SMILES for CID 66854265 is Cc1ccc(Cn2cc(C(=O)Nc3cc(-c4cc5cc(C(O[Si](C)C)C(C)(C)C)ccc5n4C(=O)OC(C)(C)C)c(=O)n(COCC[Si](C)(C)C)c3)cn2)cc1.
What is the InChIKey of CID 66854265?
The InChIKey is WPXCLYJREBRFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H58N5O6Si2/c1-29-13-15-30(16-14-29)25-47-26-33(24-44-47)39(49)45-34-23-35(40(50)46(27-34)28-52-19-20-56(10,11)12)37-22-32-21-31(38(42(2,3)4)54-55(8)9)17-18-36(32)48(37)41(51)53-43(5,6)7/h13-18,21-24,26-27,38H,19-20,25,28H2,1-12H3,(H,45,49).
What are the key properties of CID 66854265?
CID 66854265 has a molecular weight of 797.14 g/mol, XLogP of 9.73, 13 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66854265 is sourced from PubChem (CID 66854265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).