About 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one
6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one (PubChem CID 66854458) has the molecular formula C18H9Cl4N3O2
and a molecular weight of 441.10 g/mol. Its IUPAC name is 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one |
| PubChem CID | 66854458 |
| Molecular Formula | C18H9Cl4N3O2 |
| Molecular Weight | 441.10 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one |
| SMILES | Cc1cc(Cl)cc2c(=O)oc(-c3cc(Cl)c(Cl)n3-c3ncccc3Cl)nc12 |
| InChI | InChI=1S/C18H9Cl4N3O2/c1-8-5-9(19)6-10-14(8)24-17(27-18(10)26)13-7-12(21)15(22)25(13)16-11(20)3-2-4-23-16/h2-7H,1H3 |
| InChIKey | LUYPMQJPPDQDJD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.10 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one?
The IUPAC name of 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one (CID 66854458) is 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one?
The canonical SMILES for 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one is Cc1cc(Cl)cc2c(=O)oc(-c3cc(Cl)c(Cl)n3-c3ncccc3Cl)nc12.
What is the InChIKey of 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one?
The InChIKey is LUYPMQJPPDQDJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9Cl4N3O2/c1-8-5-9(19)6-10-14(8)24-17(27-18(10)26)13-7-12(21)15(22)25(13)16-11(20)3-2-4-23-16/h2-7H,1H3.
What are the key properties of 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one?
6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one has a molecular weight of 441.10 g/mol, XLogP of 5.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[4,5-dichloro-1-(3-chloro-2-pyridinyl)pyrrol-2-yl]-8-methyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 66854458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).