About 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole
2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole (PubChem CID 66855428) has the molecular formula C18H26N4
and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole.
Molecular Properties
| Compound Name | 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole |
| PubChem CID | 66855428 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole |
| SMILES | CCc1cccc(C(C)C)c1CC1=NCCN1.c1c[nH]cn1 |
| InChI | InChI=1S/C15H22N2.C3H4N2/c1-4-12-6-5-7-13(11(2)3)14(12)10-15-16-8-9-17-15;1-2-5-3-4-1/h5-7,11H,4,8-10H2,1-3H3,(H,16,17);1-3H,(H,4,5) |
| InChIKey | HPOFIIFVGIHHIL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole?
The IUPAC name of 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole (CID 66855428) is 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole.
What is the SMILES notation for 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole?
The canonical SMILES for 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole is CCc1cccc(C(C)C)c1CC1=NCCN1.c1c[nH]cn1.
What is the InChIKey of 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole?
The InChIKey is HPOFIIFVGIHHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2.C3H4N2/c1-4-12-6-5-7-13(11(2)3)14(12)10-15-16-8-9-17-15;1-2-5-3-4-1/h5-7,11H,4,8-10H2,1-3H3,(H,16,17);1-3H,(H,4,5).
What are the key properties of 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole?
2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole has a molecular weight of 298.43 g/mol, XLogP of 3.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethyl-6-propan-2-ylphenyl)methyl]-4,5-dihydro-1H-imidazole;1H-imidazole is sourced from PubChem (CID 66855428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).