About thieno[3,2-b]pyridine-7-carbonitrile
thieno[3,2-b]pyridine-7-carbonitrile (PubChem CID 66855463) has the molecular formula C8H4N2S
and a molecular weight of 160.20 g/mol. Its IUPAC name is thieno[3,2-b]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | thieno[3,2-b]pyridine-7-carbonitrile |
| PubChem CID | 66855463 |
| Molecular Formula | C8H4N2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | thieno[3,2-b]pyridine-7-carbonitrile |
| SMILES | N#Cc1ccnc2ccsc12 |
| InChI | InChI=1S/C8H4N2S/c9-5-6-1-3-10-7-2-4-11-8(6)7/h1-4H |
| InChIKey | YSTMLMGSZZBOKL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[3,2-b]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-b]pyridine-7-carbonitrile?
The IUPAC name of thieno[3,2-b]pyridine-7-carbonitrile (CID 66855463) is thieno[3,2-b]pyridine-7-carbonitrile.
What is the SMILES notation for thieno[3,2-b]pyridine-7-carbonitrile?
The canonical SMILES for thieno[3,2-b]pyridine-7-carbonitrile is N#Cc1ccnc2ccsc12.
What is the InChIKey of thieno[3,2-b]pyridine-7-carbonitrile?
The InChIKey is YSTMLMGSZZBOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2S/c9-5-6-1-3-10-7-2-4-11-8(6)7/h1-4H.
What are the key properties of thieno[3,2-b]pyridine-7-carbonitrile?
thieno[3,2-b]pyridine-7-carbonitrile has a molecular weight of 160.20 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]pyridine-7-carbonitrile is sourced from PubChem (CID 66855463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).