C20H17F3N6O — CID 66855626
5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-2-methyl-N-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-amine (PubChem CID 66855626) has the molecular formula C20H17F3N6O and a molecular weight of 414.39 g/mol. Its IUPAC name is 5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-2-methyl-N-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-2-methyl-N-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 66855626 |
| Molecular Formula | C20H17F3N6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-2-methyl-N-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-amine |
| SMILES | COc1cc(-c2nc(Nc3cc(F)c(F)c(F)c3)n(C)n2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C20H17F3N6O/c1-11-9-29(10-24-11)16-5-4-12(6-17(16)30-3)19-26-20(28(2)27-19)25-13-7-14(21)18(23)15(22)8-13/h4-10H,1-3H3,(H,25,26,27) |
| InChIKey | COAZJCWUUKESRJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|