About (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid
(E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 66856039) has the molecular formula C16H19F3O2
and a molecular weight of 300.32 g/mol. Its IUPAC name is (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| PubChem CID | 66856039 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | CCCc1cc(C(F)(F)F)cc(CCC)c1/C=C/C(=O)O |
| InChI | InChI=1S/C16H19F3O2/c1-3-5-11-9-13(16(17,18)19)10-12(6-4-2)14(11)7-8-15(20)21/h7-10H,3-6H2,1-2H3,(H,20,21)/b8-7+ |
| InChIKey | KZJQCKWTYHQNCZ-BQYQJAHWSA-N |
| XLogP | 4.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid?
The IUPAC name of (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid (CID 66856039) is (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid is CCCc1cc(C(F)(F)F)cc(CCC)c1/C=C/C(=O)O.
What is the InChIKey of (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid?
The InChIKey is KZJQCKWTYHQNCZ-BQYQJAHWSA-N. The full InChI is InChI=1S/C16H19F3O2/c1-3-5-11-9-13(16(17,18)19)10-12(6-4-2)14(11)7-8-15(20)21/h7-10H,3-6H2,1-2H3,(H,20,21)/b8-7+.
What are the key properties of (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid?
(E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid has a molecular weight of 300.32 g/mol, XLogP of 4.71, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2,6-dipropyl-4-(trifluoromethyl)phenyl]prop-2-enoic acid is sourced from PubChem (CID 66856039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).