C17H25F3N2O3S — CID 66856082
(E)-1-[4-(trifluoromethylsulfonyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one (PubChem CID 66856082) has the molecular formula C17H25F3N2O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is (E)-1-[4-(trifluoromethylsulfonyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(trifluoromethylsulfonyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66856082 |
| Molecular Formula | C17H25F3N2O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (E)-1-[4-(trifluoromethylsulfonyl)piperazin-1-yl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
| SMILES | CC1=C(/C=C/C(=O)N2CCN(S(=O)(=O)C(F)(F)F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H25F3N2O3S/c1-13-5-4-8-16(2,3)14(13)6-7-15(23)21-9-11-22(12-10-21)26(24,25)17(18,19)20/h6-7H,4-5,8-12H2,1-3H3/b7-6+ |
| InChIKey | GCPADKDOCCBXTC-VOTSOKGWSA-N |
| XLogP | 3.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|