About 6-methylpyrazolo[5,1-b][1,3]thiazole
6-methylpyrazolo[5,1-b][1,3]thiazole (PubChem CID 66856117) has the molecular formula C6H6N2S
and a molecular weight of 138.19 g/mol. Its IUPAC name is 6-methylpyrazolo[5,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-methylpyrazolo[5,1-b][1,3]thiazole |
| PubChem CID | 66856117 |
| Molecular Formula | C6H6N2S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 6-methylpyrazolo[5,1-b][1,3]thiazole |
| SMILES | Cc1cc2sccn2n1 |
| InChI | InChI=1S/C6H6N2S/c1-5-4-6-8(7-5)2-3-9-6/h2-4H,1H3 |
| InChIKey | KUPYOSTZSFXQFI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylpyrazolo[5,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyrazolo[5,1-b][1,3]thiazole?
The IUPAC name of 6-methylpyrazolo[5,1-b][1,3]thiazole (CID 66856117) is 6-methylpyrazolo[5,1-b][1,3]thiazole.
What is the SMILES notation for 6-methylpyrazolo[5,1-b][1,3]thiazole?
The canonical SMILES for 6-methylpyrazolo[5,1-b][1,3]thiazole is Cc1cc2sccn2n1.
What is the InChIKey of 6-methylpyrazolo[5,1-b][1,3]thiazole?
The InChIKey is KUPYOSTZSFXQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2S/c1-5-4-6-8(7-5)2-3-9-6/h2-4H,1H3.
What are the key properties of 6-methylpyrazolo[5,1-b][1,3]thiazole?
6-methylpyrazolo[5,1-b][1,3]thiazole has a molecular weight of 138.19 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyrazolo[5,1-b][1,3]thiazole is sourced from PubChem (CID 66856117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).