C41H43NO5 — CID 66856128
ethyl 4-[4-[4-(1,3-dioxoisoindol-2-yl)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate (PubChem CID 66856128) has the molecular formula C41H43NO5 and a molecular weight of 629.80 g/mol. Its IUPAC name is ethyl 4-[4-[4-(1,3-dioxoisoindol-2-yl)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate.
| Compound Name | ethyl 4-[4-[4-(1,3-dioxoisoindol-2-yl)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 66856128 |
| Molecular Formula | C41H43NO5 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | ethyl 4-[4-[4-(1,3-dioxoisoindol-2-yl)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCCN3C(=O)c4ccccc4C3=O)c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)c2)cc1 |
| InChI | InChI=1S/C41H43NO5/c1-6-46-39(45)28-15-13-27(14-16-28)29-18-20-36(47-24-10-9-23-42-37(43)31-11-7-8-12-32(31)38(42)44)33(25-29)30-17-19-34-35(26-30)41(4,5)22-21-40(34,2)3/h7-8,11-20,25-26H,6,9-10,21-24H2,1-5H3 |
| InChIKey | BRBPYFXLTNHQIG-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|