C40H41NO5 — CID 66856613
ethyl 4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate (PubChem CID 66856613) has the molecular formula C40H41NO5 and a molecular weight of 615.77 g/mol. Its IUPAC name is ethyl 4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate.
| Compound Name | ethyl 4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 66856613 |
| Molecular Formula | C40H41NO5 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | ethyl 4-[4-[3-(1,3-dioxoisoindol-2-yl)propoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(OCCCN3C(=O)c4ccccc4C3=O)c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)c2)cc1 |
| InChI | InChI=1S/C40H41NO5/c1-6-45-38(44)27-14-12-26(13-15-27)28-17-19-35(46-23-9-22-41-36(42)30-10-7-8-11-31(30)37(41)43)32(24-28)29-16-18-33-34(25-29)40(4,5)21-20-39(33,2)3/h7-8,10-19,24-25H,6,9,20-23H2,1-5H3 |
| InChIKey | CQJAZSDASUBFGW-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|