C17H25F2N3O2 — CID 66856655
4-[(E)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide (PubChem CID 66856655) has the molecular formula C17H25F2N3O2 and a molecular weight of 341.40 g/mol. Its IUPAC name is 4-[(E)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide.
| Compound Name | 4-[(E)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 66856655 |
| Molecular Formula | C17H25F2N3O2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[(E)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide |
| SMILES | CC1=C(/C=C/C(=O)N2CCN(C(N)=O)CC2)C(C)(C)CCC1(F)F |
| InChI | InChI=1S/C17H25F2N3O2/c1-12-13(16(2,3)6-7-17(12,18)19)4-5-14(23)21-8-10-22(11-9-21)15(20)24/h4-5H,6-11H2,1-3H3,(H2,20,24)/b5-4+ |
| InChIKey | QSFLHGDCAHRBQD-SNAWJCMRSA-N |
| XLogP | 2.54 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|