About 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 66856695) has the molecular formula C15H13F2N3O
and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 66856695 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc2nc(CCc3cccc(F)c3F)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C15H13F2N3O/c1-9-7-13-18-11(8-14(21)20(13)19-9)6-5-10-3-2-4-12(16)15(10)17/h2-4,7-8,19H,5-6H2,1H3 |
| InChIKey | BHKAMLCIYUVYKV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 66856695) is 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1cc2nc(CCc3cccc(F)c3F)cc(=O)n2[nH]1.
What is the InChIKey of 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is BHKAMLCIYUVYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N3O/c1-9-7-13-18-11(8-14(21)20(13)19-9)6-5-10-3-2-4-12(16)15(10)17/h2-4,7-8,19H,5-6H2,1H3.
What are the key properties of 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 289.29 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,3-difluorophenyl)ethyl]-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 66856695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).