C16H24F2N2O — CID 66856807
3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one (PubChem CID 66856807) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one.
| Compound Name | 3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 66856807 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)-1-piperazin-1-ylprop-2-en-1-one |
| SMILES | CC1=C(C=CC(=O)N2CCNCC2)C(C)(C)CCC1(F)F |
| InChI | InChI=1S/C16H24F2N2O/c1-12-13(15(2,3)6-7-16(12,17)18)4-5-14(21)20-10-8-19-9-11-20/h4-5,19H,6-11H2,1-3H3 |
| InChIKey | KMKACBGZKPYVGQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|