About 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide
4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide (PubChem CID 66857383) has the molecular formula C17H27N3O2
and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide |
| PubChem CID | 66857383 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide |
| SMILES | CC1=C(/C=C/C(=O)N2CCN(C(N)=O)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H27N3O2/c1-13-5-4-8-17(2,3)14(13)6-7-15(21)19-9-11-20(12-10-19)16(18)22/h6-7H,4-5,8-12H2,1-3H3,(H2,18,22)/b7-6+ |
| InChIKey | ISXCNDQRTAJCDE-VOTSOKGWSA-N |
| XLogP | 2.29 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide?
The IUPAC name of 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide (CID 66857383) is 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide.
What is the SMILES notation for 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide?
The canonical SMILES for 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide is CC1=C(/C=C/C(=O)N2CCN(C(N)=O)CC2)C(C)(C)CCC1.
What is the InChIKey of 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide?
The InChIKey is ISXCNDQRTAJCDE-VOTSOKGWSA-N. The full InChI is InChI=1S/C17H27N3O2/c1-13-5-4-8-17(2,3)14(13)6-7-15(21)19-9-11-20(12-10-19)16(18)22/h6-7H,4-5,8-12H2,1-3H3,(H2,18,22)/b7-6+.
What are the key properties of 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide?
4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide has a molecular weight of 305.42 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazine-1-carboxamide is sourced from PubChem (CID 66857383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).