C17H25F2NO — CID 66857386
(E)-1-(4,4-difluoropiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one (PubChem CID 66857386) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is (E)-1-(4,4-difluoropiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4,4-difluoropiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66857386 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (E)-1-(4,4-difluoropiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
| SMILES | CC1=C(/C=C/C(=O)N2CCC(F)(F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H25F2NO/c1-13-5-4-8-16(2,3)14(13)6-7-15(21)20-11-9-17(18,19)10-12-20/h6-7H,4-5,8-12H2,1-3H3/b7-6+ |
| InChIKey | GDCDMEPLPGELCG-VOTSOKGWSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|