C27H28F2NO6P — CID 66857733
3-[(6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl dihydrogen phosphate (PubChem CID 66857733) has the molecular formula C27H28F2NO6P and a molecular weight of 531.49 g/mol. Its IUPAC name is 3-[(6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl dihydrogen phosphate.
| Compound Name | 3-[(6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 66857733 |
| Molecular Formula | C27H28F2NO6P |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 3-[(6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl dihydrogen phosphate |
| SMILES | C[C@@H](c1ccc(-c2ccc(F)cc2F)cc1)N1CC[C@@](CCCOP(=O)(O)O)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C27H28F2NO6P/c1-19(20-8-10-21(11-9-20)24-13-12-23(28)18-25(24)29)30-16-15-27(36-26(30)31,22-6-3-2-4-7-22)14-5-17-35-37(32,33)34/h2-4,6-13,18-19H,5,14-17H2,1H3,(H2,32,33,34)/t19-,27-/m0/s1 |
| InChIKey | GZFZXHRKAMTMOX-PPHZAIPVSA-N |
| XLogP | 6.32 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|