C19H28N2O5S2 — CID 66857988
2-[2-[(4S)-4-[(E)-4-hydroxy-4-methylnon-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66857988) has the molecular formula C19H28N2O5S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[2-[(4S)-4-[(E)-4-hydroxy-4-methylnon-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(4S)-4-[(E)-4-hydroxy-4-methylnon-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66857988 |
| Molecular Formula | C19H28N2O5S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-[2-[(4S)-4-[(E)-4-hydroxy-4-methylnon-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCCC(C)(O)C/C=C/[C@H]1COC(=O)N1CCSc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C19H28N2O5S2/c1-3-4-5-8-19(2,25)9-6-7-14-12-26-18(24)21(14)10-11-27-17-20-15(13-28-17)16(22)23/h6-7,13-14,25H,3-5,8-12H2,1-2H3,(H,22,23)/b7-6+/t14-,19?/m0/s1 |
| InChIKey | WSOCKOXJPAJUMP-UXKPEMIOSA-N |
| XLogP | 4.03 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|