C24H18F3N3O4 — CID 66858557
methyl 4-[[1-[[4-(difluoromethoxy)phenyl]methyl]-7-fluoroindazol-3-yl]carbamoyl]benzoate (PubChem CID 66858557) has the molecular formula C24H18F3N3O4 and a molecular weight of 469.42 g/mol. Its IUPAC name is methyl 4-[[1-[[4-(difluoromethoxy)phenyl]methyl]-7-fluoroindazol-3-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[1-[[4-(difluoromethoxy)phenyl]methyl]-7-fluoroindazol-3-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 66858557 |
| Molecular Formula | C24H18F3N3O4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | methyl 4-[[1-[[4-(difluoromethoxy)phenyl]methyl]-7-fluoroindazol-3-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2nn(Cc3ccc(OC(F)F)cc3)c3c(F)cccc23)cc1 |
| InChI | InChI=1S/C24H18F3N3O4/c1-33-23(32)16-9-7-15(8-10-16)22(31)28-21-18-3-2-4-19(25)20(18)30(29-21)13-14-5-11-17(12-6-14)34-24(26)27/h2-12,24H,13H2,1H3,(H,28,29,31) |
| InChIKey | DCGNYHZXPPEQKI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |