About (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid
(2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid (PubChem CID 66858646) has the molecular formula C21H23N3O4
and a molecular weight of 381.43 g/mol. Its IUPAC name is (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid.
Molecular Properties
| Compound Name | (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid |
| PubChem CID | 66858646 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid |
| SMILES | CC/C(=C\c1c(C)nn(C)c1-n1ccc2ccc(OCC(C)=O)cc21)C(=O)O |
| InChI | InChI=1S/C21H23N3O4/c1-5-15(21(26)27)10-18-14(3)22-23(4)20(18)24-9-8-16-6-7-17(11-19(16)24)28-12-13(2)25/h6-11H,5,12H2,1-4H3,(H,26,27)/b15-10+ |
| InChIKey | RRSMQPUGNZSSHA-XNTDXEJSSA-N |
| XLogP | 3.52 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid?
The IUPAC name of (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid (CID 66858646) is (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid.
What is the SMILES notation for (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid?
The canonical SMILES for (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid is CC/C(=C\c1c(C)nn(C)c1-n1ccc2ccc(OCC(C)=O)cc21)C(=O)O.
What is the InChIKey of (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid?
The InChIKey is RRSMQPUGNZSSHA-XNTDXEJSSA-N. The full InChI is InChI=1S/C21H23N3O4/c1-5-15(21(26)27)10-18-14(3)22-23(4)20(18)24-9-8-16-6-7-17(11-19(16)24)28-12-13(2)25/h6-11H,5,12H2,1-4H3,(H,26,27)/b15-10+.
What are the key properties of (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid?
(2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid has a molecular weight of 381.43 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]methylidene]butanoic acid is sourced from PubChem (CID 66858646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).