C24H24ClF4N7O2 — CID 66858723
5-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 66858723) has the molecular formula C24H24ClF4N7O2 and a molecular weight of 553.95 g/mol. Its IUPAC name is 5-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 66858723 |
| Molecular Formula | C24H24ClF4N7O2 |
| Molecular Weight | 553.95 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 5-[5-chloro-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentyl]-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | COc1cc(Nc2n[nH]c(C(CCCCCl)c3ccc(OC(F)(F)F)c(F)c3)n2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C24H24ClF4N7O2/c1-14-30-13-36(35-14)19-8-7-16(12-21(19)37-2)31-23-32-22(33-34-23)17(5-3-4-10-25)15-6-9-20(18(26)11-15)38-24(27,28)29/h6-9,11-13,17H,3-5,10H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | UXUMPEKEFQMFFW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.95 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|