C17H18N4O2 — CID 66858827
(E)-3-[3-cyclopropyl-5-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-1-methylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 66858827) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (E)-3-[3-cyclopropyl-5-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-1-methylpyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-cyclopropyl-5-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-1-methylpyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66858827 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (E)-3-[3-cyclopropyl-5-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-1-methylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cn1nc(C2CC2)c(/C=C/C(=O)O)c1N1CCc2cccnc21 |
| InChI | InChI=1S/C17H18N4O2/c1-20-17(21-10-8-12-3-2-9-18-16(12)21)13(6-7-14(22)23)15(19-20)11-4-5-11/h2-3,6-7,9,11H,4-5,8,10H2,1H3,(H,22,23)/b7-6+ |
| InChIKey | DMCUAVYBLWHTKB-VOTSOKGWSA-N |
| XLogP | 2.48 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|