About (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide
(E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide (PubChem CID 66859135) has the molecular formula C21H26N4O3S
and a molecular weight of 414.53 g/mol. Its IUPAC name is (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide |
| PubChem CID | 66859135 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)/C=C/c1c(C)nn(C)c1-n1ccc2ccccc21 |
| InChI | InChI=1S/C21H26N4O3S/c1-4-5-8-15-29(27,28)23-20(26)12-11-18-16(2)22-24(3)21(18)25-14-13-17-9-6-7-10-19(17)25/h6-7,9-14H,4-5,8,15H2,1-3H3,(H,23,26)/b12-11+ |
| InChIKey | YSUKCWWUDMERGR-VAWYXSNFSA-N |
| XLogP | 3.32 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide?
The IUPAC name of (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide (CID 66859135) is (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide.
What is the SMILES notation for (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide?
The canonical SMILES for (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide is CCCCCS(=O)(=O)NC(=O)/C=C/c1c(C)nn(C)c1-n1ccc2ccccc21.
What is the InChIKey of (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide?
The InChIKey is YSUKCWWUDMERGR-VAWYXSNFSA-N. The full InChI is InChI=1S/C21H26N4O3S/c1-4-5-8-15-29(27,28)23-20(26)12-11-18-16(2)22-24(3)21(18)25-14-13-17-9-6-7-10-19(17)25/h6-7,9-14H,4-5,8,15H2,1-3H3,(H,23,26)/b12-11+.
What are the key properties of (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide?
(E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide has a molecular weight of 414.53 g/mol, XLogP of 3.32, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(5-indol-1-yl-1,3-dimethylpyrazol-4-yl)-N-pentylsulfonylprop-2-enamide is sourced from PubChem (CID 66859135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).