C22H28N6O3S — CID 66859235
3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)-N-(3-methylbutylsulfamoyl)prop-2-enamide (PubChem CID 66859235) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)-N-(3-methylbutylsulfamoyl)prop-2-enamide.
| Compound Name | 3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)-N-(3-methylbutylsulfamoyl)prop-2-enamide |
|---|---|
| PubChem CID | 66859235 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)-N-(3-methylbutylsulfamoyl)prop-2-enamide |
| SMILES | CC(C)CCNS(=O)(=O)NC(=O)C=Cc1c(C2CC2)nn(C)c1-n1ccc2cccnc21 |
| InChI | InChI=1S/C22H28N6O3S/c1-15(2)10-13-24-32(30,31)26-19(29)9-8-18-20(16-6-7-16)25-27(3)22(18)28-14-11-17-5-4-12-23-21(17)28/h4-5,8-9,11-12,14-16,24H,6-7,10,13H2,1-3H3,(H,26,29) |
| InChIKey | FVRLUDCCOKCQME-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|