C22H27FN4O4S — CID 66859273
(E)-3-[5-(5-fluoroindol-1-yl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide (PubChem CID 66859273) has the molecular formula C22H27FN4O4S and a molecular weight of 462.55 g/mol. Its IUPAC name is (E)-3-[5-(5-fluoroindol-1-yl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | (E)-3-[5-(5-fluoroindol-1-yl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 66859273 |
| Molecular Formula | C22H27FN4O4S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (E)-3-[5-(5-fluoroindol-1-yl)-3-(methoxymethyl)-1-methylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)/C=C/c1c(COC)nn(C)c1-n1ccc2cc(F)ccc21 |
| InChI | InChI=1S/C22H27FN4O4S/c1-4-5-6-13-32(29,30)25-21(28)10-8-18-19(15-31-3)24-26(2)22(18)27-12-11-16-14-17(23)7-9-20(16)27/h7-12,14H,4-6,13,15H2,1-3H3,(H,25,28)/b10-8+ |
| InChIKey | ADFOKKLARDOMQZ-CSKARUKUSA-N |
| XLogP | 3.30 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|