C22H19Cl2F3N6 — CID 66859292
5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3,5-difluorophenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 66859292) has the molecular formula C22H19Cl2F3N6 and a molecular weight of 495.34 g/mol. Its IUPAC name is 5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3,5-difluorophenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3,5-difluorophenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 66859292 |
| Molecular Formula | C22H19Cl2F3N6 |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3,5-difluorophenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | Fc1ccc(C(CCCCCl)c2nc(Nc3cc(F)c(-n4cnc(Cl)c4)c(F)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C22H19Cl2F3N6/c23-8-2-1-3-16(13-4-6-14(25)7-5-13)21-30-22(32-31-21)29-15-9-17(26)20(18(27)10-15)33-11-19(24)28-12-33/h4-7,9-12,16H,1-3,8H2,(H2,29,30,31,32) |
| InChIKey | YORVWHWZZLMKRW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|