About 2-(4,4-difluorocyclohexyl)acetonitrile
2-(4,4-difluorocyclohexyl)acetonitrile (PubChem CID 66859332) has the molecular formula C8H11F2N
and a molecular weight of 159.18 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)acetonitrile |
| PubChem CID | 66859332 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)acetonitrile |
| SMILES | N#CCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H11F2N/c9-8(10)4-1-7(2-5-8)3-6-11/h7H,1-5H2 |
| InChIKey | YCPSRZKMHXVJDI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4,4-difluorocyclohexyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)acetonitrile?
The IUPAC name of 2-(4,4-difluorocyclohexyl)acetonitrile (CID 66859332) is 2-(4,4-difluorocyclohexyl)acetonitrile.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)acetonitrile?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)acetonitrile is N#CCC1CCC(F)(F)CC1.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)acetonitrile?
The InChIKey is YCPSRZKMHXVJDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N/c9-8(10)4-1-7(2-5-8)3-6-11/h7H,1-5H2.
What are the key properties of 2-(4,4-difluorocyclohexyl)acetonitrile?
2-(4,4-difluorocyclohexyl)acetonitrile has a molecular weight of 159.18 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)acetonitrile is sourced from PubChem (CID 66859332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).